C6H2ClF3N2O6S — CID 134662841
2-nitro-6-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride (PubChem CID 134662841) has the molecular formula C6H2ClF3N2O6S and a molecular weight of 322.60 g/mol. Its IUPAC name is 2-nitro-6-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride.
| Compound Name | 2-nitro-6-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride |
|---|---|
| PubChem CID | 134662841 |
| Molecular Formula | C6H2ClF3N2O6S |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | 2-nitro-6-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride |
| SMILES | O=c1cc(S(=O)(=O)Cl)c(OC(F)(F)F)c([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C6H2ClF3N2O6S/c7-19(16,17)2-1-3(13)11-5(12(14)15)4(2)18-6(8,9)10/h1H,(H,11,13) |
| InChIKey | YOGKIOOYZRBKAQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|