C6H2ClF4NO4S — CID 131404456
6-fluoro-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride (PubChem CID 131404456) has the molecular formula C6H2ClF4NO4S and a molecular weight of 295.60 g/mol. Its IUPAC name is 6-fluoro-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride.
| Compound Name | 6-fluoro-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride |
|---|---|
| PubChem CID | 131404456 |
| Molecular Formula | C6H2ClF4NO4S |
| Molecular Weight | 295.60 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 6-fluoro-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-sulfonyl chloride |
| SMILES | O=c1[nH]c(F)cc(S(=O)(=O)Cl)c1OC(F)(F)F |
| InChI | InChI=1S/C6H2ClF4NO4S/c7-17(14,15)2-1-3(8)12-5(13)4(2)16-6(9,10)11/h1H,(H,12,13) |
| InChIKey | HZLSNNGRTJOCGW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|