C8H3F8NO2 — CID 134663177
6-(difluoromethyl)-4-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-ol (PubChem CID 134663177) has the molecular formula C8H3F8NO2 and a molecular weight of 297.10 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-ol.
| Compound Name | 6-(difluoromethyl)-4-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 134663177 |
| Molecular Formula | C8H3F8NO2 |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 6-(difluoromethyl)-4-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-ol |
| SMILES | Oc1c(OC(F)(F)F)cc(C(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C8H3F8NO2/c9-6(10)2-1-3(19-8(14,15)16)4(18)5(17-2)7(11,12)13/h1,6,18H |
| InChIKey | GDLABODQMAPVOE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |