C11H11F5N2O3 — CID 134663608
ethyl 6-(aminomethyl)-4-(difluoromethyl)-2-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134663608) has the molecular formula C11H11F5N2O3 and a molecular weight of 314.21 g/mol. Its IUPAC name is ethyl 6-(aminomethyl)-4-(difluoromethyl)-2-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(aminomethyl)-4-(difluoromethyl)-2-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134663608 |
| Molecular Formula | C11H11F5N2O3 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | ethyl 6-(aminomethyl)-4-(difluoromethyl)-2-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)F)cc(CN)nc1OC(F)(F)F |
| InChI | InChI=1S/C11H11F5N2O3/c1-2-20-10(19)7-6(8(12)13)3-5(4-17)18-9(7)21-11(14,15)16/h3,8H,2,4,17H2,1H3 |
| InChIKey | CUKYYVAIQDRQRU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |