C6H4ClF3N2O2S — CID 134663670
3-chloro-6-(difluoromethyl)-4-fluoropyridine-2-sulfonamide (PubChem CID 134663670) has the molecular formula C6H4ClF3N2O2S and a molecular weight of 260.62 g/mol. Its IUPAC name is 3-chloro-6-(difluoromethyl)-4-fluoropyridine-2-sulfonamide.
| Compound Name | 3-chloro-6-(difluoromethyl)-4-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134663670 |
| Molecular Formula | C6H4ClF3N2O2S |
| Molecular Weight | 260.62 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 3-chloro-6-(difluoromethyl)-4-fluoropyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc(C(F)F)cc(F)c1Cl |
| InChI | InChI=1S/C6H4ClF3N2O2S/c7-4-2(8)1-3(5(9)10)12-6(4)15(11,13)14/h1,5H,(H2,11,13,14) |
| InChIKey | YIFNWMULOMCYSR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.62 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |