C6H2ClF4NO2S — CID 130099937
6-(difluoromethyl)-2,4-difluoropyridine-3-sulfonyl chloride (PubChem CID 130099937) has the molecular formula C6H2ClF4NO2S and a molecular weight of 263.60 g/mol. Its IUPAC name is 6-(difluoromethyl)-2,4-difluoropyridine-3-sulfonyl chloride.
| Compound Name | 6-(difluoromethyl)-2,4-difluoropyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 130099937 |
| Molecular Formula | C6H2ClF4NO2S |
| Molecular Weight | 263.60 g/mol |
| Exact Mass | 262.94 |
| IUPAC Name | 6-(difluoromethyl)-2,4-difluoropyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c(F)cc(C(F)F)nc1F |
| InChI | InChI=1S/C6H2ClF4NO2S/c7-15(13,14)4-2(8)1-3(5(9)10)12-6(4)11/h1,5H |
| InChIKey | IGUXEQRPPIQKFD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|