C9H5F8NO2 — CID 134665221
3-(difluoromethyl)-2-methoxy-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine (PubChem CID 134665221) has the molecular formula C9H5F8NO2 and a molecular weight of 311.13 g/mol. Its IUPAC name is 3-(difluoromethyl)-2-methoxy-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine.
| Compound Name | 3-(difluoromethyl)-2-methoxy-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134665221 |
| Molecular Formula | C9H5F8NO2 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3-(difluoromethyl)-2-methoxy-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine |
| SMILES | COc1nc(C(F)(F)F)cc(OC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H5F8NO2/c1-19-7-5(6(10)11)3(20-9(15,16)17)2-4(18-7)8(12,13)14/h2,6H,1H3 |
| InChIKey | FTDDBVCQOMTETO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |