C9H2F8N2O — CID 119011943
3-(difluoromethyl)-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 119011943) has the molecular formula C9H2F8N2O and a molecular weight of 306.11 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 3-(difluoromethyl)-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 119011943 |
| Molecular Formula | C9H2F8N2O |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-(difluoromethyl)-4-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(C(F)(F)F)cc(OC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H2F8N2O/c10-7(11)6-3(2-18)19-5(8(12,13)14)1-4(6)20-9(15,16)17/h1,7H |
| InChIKey | YMFKLHHBHHNZDD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |