C9H4BrF6NO2 — CID 134667822
5-(bromomethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carbaldehyde (PubChem CID 134667822) has the molecular formula C9H4BrF6NO2 and a molecular weight of 352.03 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carbaldehyde.
| Compound Name | 5-(bromomethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 134667822 |
| Molecular Formula | C9H4BrF6NO2 |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 5-(bromomethyl)-3-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-2-carbaldehyde |
| SMILES | O=Cc1ncc(CBr)c(C(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C9H4BrF6NO2/c10-1-4-2-17-5(3-18)7(19-9(14,15)16)6(4)8(11,12)13/h2-3H,1H2 |
| InChIKey | LQFFYFFUMZIJPX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|