C8H4F5NO3 — CID 134680955
6-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carboxylic acid (PubChem CID 134680955) has the molecular formula C8H4F5NO3 and a molecular weight of 257.11 g/mol. Its IUPAC name is 6-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carboxylic acid.
| Compound Name | 6-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 134680955 |
| Molecular Formula | C8H4F5NO3 |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 6-fluoro-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(OC(F)(F)F)cc(F)nc1CF |
| InChI | InChI=1S/C8H4F5NO3/c9-2-3-6(7(15)16)4(1-5(10)14-3)17-8(11,12)13/h1H,2H2,(H,15,16) |
| InChIKey | MZNMYCQKBCXDBJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|