C8H3BrClF6NO3S — CID 134683104
5-(bromomethyl)-6-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-3-sulfonyl chloride (PubChem CID 134683104) has the molecular formula C8H3BrClF6NO3S and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-(bromomethyl)-6-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-3-sulfonyl chloride.
| Compound Name | 5-(bromomethyl)-6-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 134683104 |
| Molecular Formula | C8H3BrClF6NO3S |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 420.86 |
| IUPAC Name | 5-(bromomethyl)-6-(trifluoromethoxy)-4-(trifluoromethyl)pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cnc(OC(F)(F)F)c(CBr)c1C(F)(F)F |
| InChI | InChI=1S/C8H3BrClF6NO3S/c9-1-3-5(7(11,12)13)4(21(10,18)19)2-17-6(3)20-8(14,15)16/h2H,1H2 |
| InChIKey | BQJZHGGPPLEFSC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|