C11H18 — CID 13468514
(1S,2R,4S,6R)-2,7,7-trimethyltricyclo[4.1.1.02,4]octane (PubChem CID 13468514) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is (1S,2R,4S,6R)-2,7,7-trimethyltricyclo[4.1.1.02,4]octane.
| Compound Name | (1S,2R,4S,6R)-2,7,7-trimethyltricyclo[4.1.1.02,4]octane |
|---|---|
| PubChem CID | 13468514 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1S,2R,4S,6R)-2,7,7-trimethyltricyclo[4.1.1.02,4]octane |
| SMILES | CC1(C)[C@@H]2C[C@H]3C[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C11H18/c1-10(2)7-4-8-6-11(8,3)9(10)5-7/h7-9H,4-6H2,1-3H3/t7-,8+,9+,11-/m1/s1 |
| InChIKey | GEQMFRCCAZCZMF-UYAYMFIHSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |