C9H5BrF5NO2 — CID 134685323
2-[6-bromo-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 134685323) has the molecular formula C9H5BrF5NO2 and a molecular weight of 334.04 g/mol. Its IUPAC name is 2-[6-bromo-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-bromo-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134685323 |
| Molecular Formula | C9H5BrF5NO2 |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 2-[6-bromo-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1nc(Br)cc(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H5BrF5NO2/c10-5-1-3(9(13,14)15)7(8(11)12)4(16-5)2-6(17)18/h1,8H,2H2,(H,17,18) |
| InChIKey | FPOOMKJGYGECIW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|