C9H6F5NO2 — CID 134683635
2-[5-(difluoromethyl)-3-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 134683635) has the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-3-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-(difluoromethyl)-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134683635 |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-[5-(difluoromethyl)-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ncc(C(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H6F5NO2/c10-8(11)4-1-5(9(12,13)14)6(15-3-4)2-7(16)17/h1,3,8H,2H2,(H,16,17) |
| InChIKey | DXMCTVHIPYINDI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |