C19H22N2O11P2 — CID 134686805
[(2R,4aR,6R,7aR)-6-[2,4-dioxo-5-[(E)-3-phosphonoprop-1-enyl]pyrimidin-1-yl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-2-yl]phosphonic acid (PubChem CID 134686805) has the molecular formula C19H22N2O11P2 and a molecular weight of 516.34 g/mol. Its IUPAC name is [(2R,4aR,6R,7aR)-6-[2,4-dioxo-5-[(E)-3-phosphonoprop-1-enyl]pyrimidin-1-yl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-2-yl]phosphonic acid.
| Compound Name | [(2R,4aR,6R,7aR)-6-[2,4-dioxo-5-[(E)-3-phosphonoprop-1-enyl]pyrimidin-1-yl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 134686805 |
| Molecular Formula | C19H22N2O11P2 |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | [(2R,4aR,6R,7aR)-6-[2,4-dioxo-5-[(E)-3-phosphonoprop-1-enyl]pyrimidin-1-yl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-2-yl]phosphonic acid |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H]3O[C@](c4ccccc4)(P(=O)(O)O)OC[C@H]3O2)cc1/C=C/CP(=O)(O)O |
| InChI | InChI=1S/C19H22N2O11P2/c22-17-12(5-4-8-33(24,25)26)10-21(18(23)20-17)16-9-14-15(31-16)11-30-19(32-14,34(27,28)29)13-6-2-1-3-7-13/h1-7,10,14-16H,8-9,11H2,(H,20,22,23)(H2,24,25,26)(H2,27,28,29)/b5-4+/t14-,15-,16-,19-/m1/s1 |
| InChIKey | TZXVMSWLUKAZDT-PDBOZARJSA-N |
| XLogP | 0.42 |
| TPSA | 197.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|