C15H22O6 — CID 134687619
(1S,2R,4S,7R,9R,10R,11S,12S)-3,3,4-trideuterio-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol (PubChem CID 134687619) has the molecular formula C15H22O6 and a molecular weight of 301.35 g/mol. Its IUPAC name is (1S,2R,4S,7R,9R,10R,11S,12S)-3,3,4-trideuterio-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol.
| Compound Name | (1S,2R,4S,7R,9R,10R,11S,12S)-3,3,4-trideuterio-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol |
|---|---|
| PubChem CID | 134687619 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (1S,2R,4S,7R,9R,10R,11S,12S)-3,3,4-trideuterio-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol |
| SMILES | [2H]C1([2H])[C@]([2H])(O)C(C)=C[C@H]2O[C@@H]3[C@H](O)[C@@H](O)[C@@](C)([C@]34CO4)[C@]21CO |
| InChI | InChI=1S/C15H22O6/c1-7-3-9-14(5-16,4-8(7)17)13(2)11(19)10(18)12(21-9)15(13)6-20-15/h3,8-12,16-19H,4-6H2,1-2H3/t8-,9+,10+,11+,12+,13+,14+,15-/m0/s1/i4D2,8D |
| InChIKey | ZAXZBJSXSOISTF-OUVXIMKKSA-N |
| XLogP | -1.05 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|