C16H20FN7O — CID 134689404
1-[(2S)-5-(5-fluoropyrimidin-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 134689404) has the molecular formula C16H20FN7O and a molecular weight of 345.38 g/mol. Its IUPAC name is 1-[(2S)-5-(5-fluoropyrimidin-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(2S)-5-(5-fluoropyrimidin-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 134689404 |
| Molecular Formula | C16H20FN7O |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[(2S)-5-(5-fluoropyrimidin-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1C2CCN(c3ncc(F)cn3)CC2C[C@H]1Cn1cncn1 |
| InChI | InChI=1S/C16H20FN7O/c1-11(25)24-14(8-23-10-18-9-21-23)4-12-7-22(3-2-15(12)24)16-19-5-13(17)6-20-16/h5-6,9-10,12,14-15H,2-4,7-8H2,1H3/t12?,14-,15?/m0/s1 |
| InChIKey | BIXQCBNVLMZHBQ-BLZCZZARSA-N |
| XLogP | 0.72 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |