C15H20FN7 — CID 134690565
(2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 134690565) has the molecular formula C15H20FN7 and a molecular weight of 317.37 g/mol. Its IUPAC name is (2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 134690565 |
| Molecular Formula | C15H20FN7 |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1C2CCN(c3ncc(F)cn3)CC2C[C@H]1Cn1cncn1 |
| InChI | InChI=1S/C15H20FN7/c1-21-13(8-23-10-17-9-20-23)4-11-7-22(3-2-14(11)21)15-18-5-12(16)6-19-15/h5-6,9-11,13-14H,2-4,7-8H2,1H3/t11?,13-,14?/m0/s1 |
| InChIKey | UZNQDPFIKWKCTA-QRMWWUJWSA-N |
| XLogP | 0.81 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |