C15H24FN5 — CID 134689468
1-[(2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine (PubChem CID 134689468) has the molecular formula C15H24FN5 and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-[(2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 134689468 |
| Molecular Formula | C15H24FN5 |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-[(2S)-5-(5-fluoropyrimidin-2-yl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@@H]1CC2CN(c3ncc(F)cn3)CCC2N1C |
| InChI | InChI=1S/C15H24FN5/c1-19(2)10-13-6-11-9-21(5-4-14(11)20(13)3)15-17-7-12(16)8-18-15/h7-8,11,13-14H,4-6,9-10H2,1-3H3/t11?,13-,14?/m0/s1 |
| InChIKey | SVWAGUMOZGYIAE-QRMWWUJWSA-N |
| XLogP | 1.08 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |