C16H24N4O4 — CID 134690363
2-[(2R,3aR,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 134690363) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[(2R,3aR,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2R,3aR,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 134690363 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[(2R,3aR,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@H]1C[C@@H]2CN(c3cc(OC)ncn3)C[C@H]2O1 |
| InChI | InChI=1S/C16H24N4O4/c1-22-4-3-17-15(21)6-12-5-11-8-20(9-13(11)24-12)14-7-16(23-2)19-10-18-14/h7,10-13H,3-6,8-9H2,1-2H3,(H,17,21)/t11-,12-,13-/m1/s1 |
| InChIKey | WREOKMIPERADPK-JHJVBQTASA-N |
| XLogP | 0.23 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|