C16H27N5 — CID 134690397
N,N-dimethyl-1-[(2S)-1-methyl-5-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine (PubChem CID 134690397) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2S)-1-methyl-5-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(2S)-1-methyl-5-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine |
|---|---|
| PubChem CID | 134690397 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | N,N-dimethyl-1-[(2S)-1-methyl-5-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine |
| SMILES | Cc1cnc(N2CCC3C(C[C@@H](CN(C)C)N3C)C2)nc1 |
| InChI | InChI=1S/C16H27N5/c1-12-8-17-16(18-9-12)21-6-5-15-13(10-21)7-14(20(15)4)11-19(2)3/h8-9,13-15H,5-7,10-11H2,1-4H3/t13?,14-,15?/m0/s1 |
| InChIKey | FWBKCJXYNHBONW-SLTAFYQDSA-N |
| XLogP | 1.25 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |