C8H18ClN3O — CID 134691041
1-methyl-3-(piperidin-4-ylmethyl)urea;hydrochloride (PubChem CID 134691041) has the molecular formula C8H18ClN3O and a molecular weight of 207.70 g/mol. Its IUPAC name is 1-methyl-3-(piperidin-4-ylmethyl)urea;hydrochloride.
| Compound Name | 1-methyl-3-(piperidin-4-ylmethyl)urea;hydrochloride |
|---|---|
| PubChem CID | 134691041 |
| Molecular Formula | C8H18ClN3O |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 1-methyl-3-(piperidin-4-ylmethyl)urea;hydrochloride |
| SMILES | CNC(=O)NCC1CCNCC1.Cl |
| InChI | InChI=1S/C8H17N3O.ClH/c1-9-8(12)11-6-7-2-4-10-5-3-7;/h7,10H,2-6H2,1H3,(H2,9,11,12);1H |
| InChIKey | XIPUTZWRDLPJBE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |