C10H21N3O — CID 112690170
1,1-dimethyl-3-[(1-methylpiperidin-3-yl)methyl]urea (PubChem CID 112690170) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(1-methylpiperidin-3-yl)methyl]urea.
| Compound Name | 1,1-dimethyl-3-[(1-methylpiperidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 112690170 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 1,1-dimethyl-3-[(1-methylpiperidin-3-yl)methyl]urea |
| SMILES | CN1CCCC(CNC(=O)N(C)C)C1 |
| InChI | InChI=1S/C10H21N3O/c1-12(2)10(14)11-7-9-5-4-6-13(3)8-9/h9H,4-8H2,1-3H3,(H,11,14) |
| InChIKey | AIGATEJOMWFBEZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |