C8H20Cl2N2 — CID 134691072
(4,4-dimethylcyclohexyl)hydrazine;dihydrochloride (PubChem CID 134691072) has the molecular formula C8H20Cl2N2 and a molecular weight of 215.17 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl)hydrazine;dihydrochloride.
| Compound Name | (4,4-dimethylcyclohexyl)hydrazine;dihydrochloride |
|---|---|
| PubChem CID | 134691072 |
| Molecular Formula | C8H20Cl2N2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (4,4-dimethylcyclohexyl)hydrazine;dihydrochloride |
| SMILES | CC1(C)CCC(NN)CC1.Cl.Cl |
| InChI | InChI=1S/C8H18N2.2ClH/c1-8(2)5-3-7(10-9)4-6-8;;/h7,10H,3-6,9H2,1-2H3;2*1H |
| InChIKey | XTLPAVQZNFMCEA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|