C19H18N4OS2 — CID 134692920
6-(2-methoxyphenyl)-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 134692920) has the molecular formula C19H18N4OS2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(2-methoxyphenyl)-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 134692920 |
| Molecular Formula | C19H18N4OS2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 6-(2-methoxyphenyl)-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccccc1-c1nn2c(CSCCc3ccccc3)nnc2s1 |
| InChI | InChI=1S/C19H18N4OS2/c1-24-16-10-6-5-9-15(16)18-22-23-17(20-21-19(23)26-18)13-25-12-11-14-7-3-2-4-8-14/h2-10H,11-13H2,1H3 |
| InChIKey | AVRKHZXTWBVRJT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|