C18H16N4S2 — CID 135637936
6-phenyl-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 135637936) has the molecular formula C18H16N4S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is 6-phenyl-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-phenyl-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 135637936 |
| Molecular Formula | C18H16N4S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 6-phenyl-3-(2-phenylethylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | c1ccc(CCSCc2nnc3sc(-c4ccccc4)nn23)cc1 |
| InChI | InChI=1S/C18H16N4S2/c1-3-7-14(8-4-1)11-12-23-13-16-19-20-18-22(16)21-17(24-18)15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | ROQJIIKBOBLECW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|