C32H32F2N8 — CID 134693602
6-fluoro-9-[[1-[2-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]ethyl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole (PubChem CID 134693602) has the molecular formula C32H32F2N8 and a molecular weight of 566.66 g/mol. Its IUPAC name is 6-fluoro-9-[[1-[2-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]ethyl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 6-fluoro-9-[[1-[2-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]ethyl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 134693602 |
| Molecular Formula | C32H32F2N8 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 6-fluoro-9-[[1-[2-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]ethyl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole |
| SMILES | Fc1ccc2c(c1)c1c(n2Cc2cn(CCn3cc(Cn4c5c(c6cc(F)ccc64)CCCC5)nn3)nn2)CCCC1 |
| InChI | InChI=1S/C32H32F2N8/c33-21-9-11-31-27(15-21)25-5-1-3-7-29(25)41(31)19-23-17-39(37-35-23)13-14-40-18-24(36-38-40)20-42-30-8-4-2-6-26(30)28-16-22(34)10-12-32(28)42/h9-12,15-18H,1-8,13-14,19-20H2 |
| InChIKey | DFMUSTHWLZDOCA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|