C21H18F3N5 — CID 155517206
2-[[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 155517206) has the molecular formula C21H18F3N5 and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-[[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155517206 |
| Molecular Formula | C21H18F3N5 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[[1-[2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | FC(F)(F)c1ccccc1-n1cc(CN2CCc3c([nH]c4ccccc34)C2)nn1 |
| InChI | InChI=1S/C21H18F3N5/c22-21(23,24)17-6-2-4-8-20(17)29-12-14(26-27-29)11-28-10-9-16-15-5-1-3-7-18(15)25-19(16)13-28/h1-8,12,25H,9-11,13H2 |
| InChIKey | ZGZNQOJTSRXRQP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|