C19H25FN4O — CID 134696922
N-(1-cyclopentyl-4-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide (PubChem CID 134696922) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is N-(1-cyclopentyl-4-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide.
| Compound Name | N-(1-cyclopentyl-4-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 134696922 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-(1-cyclopentyl-4-methylpyrazol-5-yl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
| SMILES | Cc1cnn(C2CCCC2)c1NC(=O)CN(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN4O/c1-14-11-21-24(17-5-3-4-6-17)19(14)22-18(25)13-23(2)12-15-7-9-16(20)10-8-15/h7-11,17H,3-6,12-13H2,1-2H3,(H,22,25) |
| InChIKey | DVHQVQCCXPDCPF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |