C15H21N3O — CID 134697458
(1R,2R,4R)-N-(4-ethyl-1,3-dimethylpyrazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 134697458) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is (1R,2R,4R)-N-(4-ethyl-1,3-dimethylpyrazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-(4-ethyl-1,3-dimethylpyrazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 134697458 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (1R,2R,4R)-N-(4-ethyl-1,3-dimethylpyrazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCc1c(C)nn(C)c1NC(=O)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H21N3O/c1-4-12-9(2)17-18(3)14(12)16-15(19)13-8-10-5-6-11(13)7-10/h5-6,10-11,13H,4,7-8H2,1-3H3,(H,16,19)/t10-,11+,13-/m1/s1 |
| InChIKey | PRXNDUJLEQTHIC-NTZNESFSSA-N |
| XLogP | 2.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|