C17H24N4O — CID 134697688
(1R,2R,4R)-N-(1,5-dimethyl-3-pyrrolidin-1-ylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 134697688) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is (1R,2R,4R)-N-(1,5-dimethyl-3-pyrrolidin-1-ylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-(1,5-dimethyl-3-pyrrolidin-1-ylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 134697688 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | (1R,2R,4R)-N-(1,5-dimethyl-3-pyrrolidin-1-ylpyrazol-4-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1c(NC(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)c(N2CCCC2)nn1C |
| InChI | InChI=1S/C17H24N4O/c1-11-15(16(19-20(11)2)21-7-3-4-8-21)18-17(22)14-10-12-5-6-13(14)9-12/h5-6,12-14H,3-4,7-10H2,1-2H3,(H,18,22)/t12-,13+,14-/m1/s1 |
| InChIKey | SCNHMTUYXLTBKG-HZSPNIEDSA-N |
| XLogP | 2.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|