C23H27N3O — CID 134698380
pyridin-2-yl-[1-(4,7,8-trimethylquinolin-2-yl)piperidin-4-yl]methanol (PubChem CID 134698380) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is pyridin-2-yl-[1-(4,7,8-trimethylquinolin-2-yl)piperidin-4-yl]methanol.
| Compound Name | pyridin-2-yl-[1-(4,7,8-trimethylquinolin-2-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 134698380 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | pyridin-2-yl-[1-(4,7,8-trimethylquinolin-2-yl)piperidin-4-yl]methanol |
| SMILES | Cc1ccc2c(C)cc(N3CCC(C(O)c4ccccn4)CC3)nc2c1C |
| InChI | InChI=1S/C23H27N3O/c1-15-7-8-19-16(2)14-21(25-22(19)17(15)3)26-12-9-18(10-13-26)23(27)20-6-4-5-11-24-20/h4-8,11,14,18,23,27H,9-10,12-13H2,1-3H3 |
| InChIKey | CHQNOUUBPHUWTB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |