C21H23N5O2 — CID 134698833
morpholin-4-yl-[2-[2-(1-phenylpyrazol-4-yl)ethylamino]-4-pyridinyl]methanone (PubChem CID 134698833) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is morpholin-4-yl-[2-[2-(1-phenylpyrazol-4-yl)ethylamino]-4-pyridinyl]methanone.
| Compound Name | morpholin-4-yl-[2-[2-(1-phenylpyrazol-4-yl)ethylamino]-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 134698833 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | morpholin-4-yl-[2-[2-(1-phenylpyrazol-4-yl)ethylamino]-4-pyridinyl]methanone |
| SMILES | O=C(c1ccnc(NCCc2cnn(-c3ccccc3)c2)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H23N5O2/c27-21(25-10-12-28-13-11-25)18-7-9-23-20(14-18)22-8-6-17-15-24-26(16-17)19-4-2-1-3-5-19/h1-5,7,9,14-16H,6,8,10-13H2,(H,22,23) |
| InChIKey | ORBAGWHUEXIEBO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |