C19H20N6O2 — CID 171356284
[1-[6-(benzylamino)pyrimidin-4-yl]pyrazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 171356284) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is [1-[6-(benzylamino)pyrimidin-4-yl]pyrazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[6-(benzylamino)pyrimidin-4-yl]pyrazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 171356284 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [1-[6-(benzylamino)pyrimidin-4-yl]pyrazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnn(-c2cc(NCc3ccccc3)ncn2)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H20N6O2/c26-19(24-6-8-27-9-7-24)16-12-23-25(13-16)18-10-17(21-14-22-18)20-11-15-4-2-1-3-5-15/h1-5,10,12-14H,6-9,11H2,(H,20,21,22) |
| InChIKey | SNVYCSHDZVNWFI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |