C21H30N2O4 — CID 134700000
N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-3-(3,4-dimethoxyphenyl)-N-methylpropanamide (PubChem CID 134700000) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-3-(3,4-dimethoxyphenyl)-N-methylpropanamide.
| Compound Name | N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-3-(3,4-dimethoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 134700000 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-3-(3,4-dimethoxyphenyl)-N-methylpropanamide |
| SMILES | COc1ccc(CCC(=O)N(C)[C@@H]2C[C@@H]3CC(=O)N(C)C[C@@H]3C2)cc1OC |
| InChI | InChI=1S/C21H30N2O4/c1-22-13-16-11-17(10-15(16)12-21(22)25)23(2)20(24)8-6-14-5-7-18(26-3)19(9-14)27-4/h5,7,9,15-17H,6,8,10-13H2,1-4H3/t15-,16+,17-/m1/s1 |
| InChIKey | LSVUANJMDNXPON-IXDOHACOSA-N |
| XLogP | 2.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |