C21H32N2O3 — CID 162634250
(4aS,6S,7aS)-6-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one (PubChem CID 162634250) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is (4aS,6S,7aS)-6-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one.
| Compound Name | (4aS,6S,7aS)-6-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 162634250 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (4aS,6S,7aS)-6-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
| SMILES | CCOCc1cc(CN(C)[C@H]2C[C@H]3CC(=O)N(C)C[C@H]3C2)ccc1OC |
| InChI | InChI=1S/C21H32N2O3/c1-5-26-14-18-8-15(6-7-20(18)25-4)12-22(2)19-9-16-11-21(24)23(3)13-17(16)10-19/h6-8,16-17,19H,5,9-14H2,1-4H3/t16-,17+,19-/m0/s1 |
| InChIKey | PSBCWLRYFSVYJK-SCTDSRPQSA-N |
| XLogP | 2.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |