C18H25N3O2 — CID 135103671
2-[[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]-N-phenylacetamide (PubChem CID 135103671) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]-N-phenylacetamide.
| Compound Name | 2-[[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]-N-phenylacetamide |
|---|---|
| PubChem CID | 135103671 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-[[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]-N-phenylacetamide |
| SMILES | CN1C[C@@H]2C[C@H](N(C)CC(=O)Nc3ccccc3)C[C@@H]2CC1=O |
| InChI | InChI=1S/C18H25N3O2/c1-20(12-17(22)19-15-6-4-3-5-7-15)16-8-13-10-18(23)21(2)11-14(13)9-16/h3-7,13-14,16H,8-12H2,1-2H3,(H,19,22)/t13-,14+,16-/m1/s1 |
| InChIKey | VLCJYCZSDPNVLD-IJEWVQPXSA-N |
| XLogP | 1.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |