C19H27N3O4S — CID 134702333
N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 134702333) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 134702333 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[(4aR,6R,7aR)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | CN1C[C@@H]2C[C@H](N(C)C(=O)c3ccc(N(C)S(C)(=O)=O)cc3)C[C@@H]2CC1=O |
| InChI | InChI=1S/C19H27N3O4S/c1-20-12-15-10-17(9-14(15)11-18(20)23)21(2)19(24)13-5-7-16(8-6-13)22(3)27(4,25)26/h5-8,14-15,17H,9-12H2,1-4H3/t14-,15+,17-/m1/s1 |
| InChIKey | BBPZHZHGIAOFEJ-HLLBOEOZSA-N |
| XLogP | 1.41 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |