C18H25N3O4S — CID 135115784
N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 135115784) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 135115784 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | CN(C(=O)c1ccc(N(C)S(C)(=O)=O)cc1)[C@H]1C[C@H]2CNC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C18H25N3O4S/c1-20(16-8-13-10-17(22)19-11-14(13)9-16)18(23)12-4-6-15(7-5-12)21(2)26(3,24)25/h4-7,13-14,16H,8-11H2,1-3H3,(H,19,22)/t13-,14+,16-/m1/s1 |
| InChIKey | PPDRAVXGSWKEGN-IJEWVQPXSA-N |
| XLogP | 1.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |