C23H26N2O3 — CID 135113679
N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-phenylmethoxybenzamide (PubChem CID 135113679) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-phenylmethoxybenzamide.
| Compound Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 135113679 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-phenylmethoxybenzamide |
| SMILES | CN(C(=O)c1ccccc1OCc1ccccc1)[C@H]1C[C@H]2CNC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C23H26N2O3/c1-25(19-11-17-13-22(26)24-14-18(17)12-19)23(27)20-9-5-6-10-21(20)28-15-16-7-3-2-4-8-16/h2-10,17-19H,11-15H2,1H3,(H,24,26)/t17-,18+,19-/m1/s1 |
| InChIKey | DUXURGFUWBMCRX-CEXWTWQISA-N |
| XLogP | 3.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |