C19H27N3O2 — CID 135102952
2-[[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]-N-(2-phenylethyl)acetamide (PubChem CID 135102952) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 135102952 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-[[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]-N-(2-phenylethyl)acetamide |
| SMILES | CN(CC(=O)NCCc1ccccc1)[C@H]1C[C@H]2CNC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C19H27N3O2/c1-22(17-9-15-11-18(23)21-12-16(15)10-17)13-19(24)20-8-7-14-5-3-2-4-6-14/h2-6,15-17H,7-13H2,1H3,(H,20,24)(H,21,23)/t15-,16+,17-/m1/s1 |
| InChIKey | WJTKOAHXEOPTJY-IXDOHACOSA-N |
| XLogP | 1.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |