C21H24N2O2 — CID 163306021
N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-naphthalen-2-ylacetamide (PubChem CID 163306021) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-naphthalen-2-ylacetamide.
| Compound Name | N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 163306021 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2-naphthalen-2-ylacetamide |
| SMILES | CN(C(=O)Cc1ccc2ccccc2c1)[C@H]1C[C@H]2CC(=O)NC[C@H]2C1 |
| InChI | InChI=1S/C21H24N2O2/c1-23(19-10-17-12-20(24)22-13-18(17)11-19)21(25)9-14-6-7-15-4-2-3-5-16(15)8-14/h2-8,17-19H,9-13H2,1H3,(H,22,24)/t17-,18+,19-/m0/s1 |
| InChIKey | LOXFEJCIDQTWNG-OTWHNJEPSA-N |
| XLogP | 2.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |