C23H31N3O4 — CID 172661030
N-[5-[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylcarbamoyl]-2-methylphenyl]oxane-4-carboxamide (PubChem CID 172661030) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[5-[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylcarbamoyl]-2-methylphenyl]oxane-4-carboxamide.
| Compound Name | N-[5-[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylcarbamoyl]-2-methylphenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 172661030 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[5-[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylcarbamoyl]-2-methylphenyl]oxane-4-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)[C@H]2C[C@H]3CC(=O)NC[C@H]3C2)cc1NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C23H31N3O4/c1-14-3-4-16(11-20(14)25-22(28)15-5-7-30-8-6-15)23(29)26(2)19-9-17-12-21(27)24-13-18(17)10-19/h3-4,11,15,17-19H,5-10,12-13H2,1-2H3,(H,24,27)(H,25,28)/t17-,18+,19-/m0/s1 |
| InChIKey | KERTYCGDDMNNMH-OTWHNJEPSA-N |
| XLogP | 2.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |