C13H17N3O4S — CID 78982712
N-[2-methyl-5-(methylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 78982712) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-[2-methyl-5-(methylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-methyl-5-(methylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78982712 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[2-methyl-5-(methylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(NC(=O)C2CNC(=O)C2)c1 |
| InChI | InChI=1S/C13H17N3O4S/c1-8-3-4-10(21(19,20)14-2)6-11(8)16-13(18)9-5-12(17)15-7-9/h3-4,6,9,14H,5,7H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | HACZYMVPSOPZHN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |