C23H26N2O2 — CID 135100334
N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2,2-diphenylacetamide (PubChem CID 135100334) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2,2-diphenylacetamide.
| Compound Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 135100334 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-[(4aR,6R,7aR)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methyl-2,2-diphenylacetamide |
| SMILES | CN(C(=O)C(c1ccccc1)c1ccccc1)[C@H]1C[C@H]2CNC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C23H26N2O2/c1-25(20-12-18-14-21(26)24-15-19(18)13-20)23(27)22(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-20,22H,12-15H2,1H3,(H,24,26)/t18-,19+,20-/m1/s1 |
| InChIKey | PIHFXUPSPFLLBI-HSALFYBXSA-N |
| XLogP | 3.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |