C18H22F4N2O — CID 135117979
(4aR,6R,7aR)-6-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one (PubChem CID 135117979) has the molecular formula C18H22F4N2O and a molecular weight of 358.38 g/mol. Its IUPAC name is (4aR,6R,7aR)-6-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one.
| Compound Name | (4aR,6R,7aR)-6-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 135117979 |
| Molecular Formula | C18H22F4N2O |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (4aR,6R,7aR)-6-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
| SMILES | CN1C[C@@H]2C[C@H](N(C)Cc3ccc(C(F)(F)F)cc3F)C[C@@H]2CC1=O |
| InChI | InChI=1S/C18H22F4N2O/c1-23(9-11-3-4-14(8-16(11)19)18(20,21)22)15-5-12-7-17(25)24(2)10-13(12)6-15/h3-4,8,12-13,15H,5-7,9-10H2,1-2H3/t12-,13+,15-/m1/s1 |
| InChIKey | VAIQUSKZMKDELH-VNHYZAJKSA-N |
| XLogP | 3.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |