C21H34N6O — CID 134700639
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide (PubChem CID 134700639) has the molecular formula C21H34N6O and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 134700639 |
| Molecular Formula | C21H34N6O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)CN3CCN(c4ncccn4)CC3)C[C@@H]2C1 |
| InChI | InChI=1S/C21H34N6O/c1-24(2)18-11-16-13-19(14-17(16)12-18)25(3)20(28)15-26-7-9-27(10-8-26)21-22-5-4-6-23-21/h4-6,16-19H,7-15H2,1-3H3/t16-,17+,18?,19? |
| InChIKey | LCNJGOHNXSDBQN-LPOKXYRGSA-N |
| XLogP | 1.18 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |