C22H25N3O3 — CID 134701048
(5R,6S)-6-(4-benzylpiperazine-1-carbonyl)-5-phenylmorpholin-3-one (PubChem CID 134701048) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (5R,6S)-6-(4-benzylpiperazine-1-carbonyl)-5-phenylmorpholin-3-one.
| Compound Name | (5R,6S)-6-(4-benzylpiperazine-1-carbonyl)-5-phenylmorpholin-3-one |
|---|---|
| PubChem CID | 134701048 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (5R,6S)-6-(4-benzylpiperazine-1-carbonyl)-5-phenylmorpholin-3-one |
| SMILES | O=C1CO[C@H](C(=O)N2CCN(Cc3ccccc3)CC2)[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C22H25N3O3/c26-19-16-28-21(20(23-19)18-9-5-2-6-10-18)22(27)25-13-11-24(12-14-25)15-17-7-3-1-4-8-17/h1-10,20-21H,11-16H2,(H,23,26)/t20-,21+/m1/s1 |
| InChIKey | AHQUEVJLQNZXSO-RTWAWAEBSA-N |
| XLogP | 1.59 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |