C17H22N2O3 — CID 134704890
(5R,6S)-6-(4-methylpiperidine-1-carbonyl)-5-phenylmorpholin-3-one (PubChem CID 134704890) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (5R,6S)-6-(4-methylpiperidine-1-carbonyl)-5-phenylmorpholin-3-one.
| Compound Name | (5R,6S)-6-(4-methylpiperidine-1-carbonyl)-5-phenylmorpholin-3-one |
|---|---|
| PubChem CID | 134704890 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (5R,6S)-6-(4-methylpiperidine-1-carbonyl)-5-phenylmorpholin-3-one |
| SMILES | CC1CCN(C(=O)[C@H]2OCC(=O)N[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N2O3/c1-12-7-9-19(10-8-12)17(21)16-15(18-14(20)11-22-16)13-5-3-2-4-6-13/h2-6,12,15-16H,7-11H2,1H3,(H,18,20)/t15-,16+/m1/s1 |
| InChIKey | PDBLECIOZBQIPM-CVEARBPZSA-N |
| XLogP | 1.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |