C21H27N3O4 — CID 134706916
(5R,6S)-6-(4-cyclohexyl-3-oxopiperazine-1-carbonyl)-5-phenylmorpholin-3-one (PubChem CID 134706916) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (5R,6S)-6-(4-cyclohexyl-3-oxopiperazine-1-carbonyl)-5-phenylmorpholin-3-one.
| Compound Name | (5R,6S)-6-(4-cyclohexyl-3-oxopiperazine-1-carbonyl)-5-phenylmorpholin-3-one |
|---|---|
| PubChem CID | 134706916 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (5R,6S)-6-(4-cyclohexyl-3-oxopiperazine-1-carbonyl)-5-phenylmorpholin-3-one |
| SMILES | O=C1CO[C@H](C(=O)N2CCN(C3CCCCC3)C(=O)C2)[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C21H27N3O4/c25-17-14-28-20(19(22-17)15-7-3-1-4-8-15)21(27)23-11-12-24(18(26)13-23)16-9-5-2-6-10-16/h1,3-4,7-8,16,19-20H,2,5-6,9-14H2,(H,22,25)/t19-,20+/m1/s1 |
| InChIKey | RVXOXOZLNCVCOW-UXHICEINSA-N |
| XLogP | 1.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |